About (2R,3R)-2-fluoro-3-iodooxane
(2R,3R)-2-fluoro-3-iodooxane (PubChem CID 23236908) has the molecular formula C5H8FIO
and a molecular weight of 230.02 g/mol. Its IUPAC name is (2R,3R)-2-fluoro-3-iodooxane.
Molecular Properties
| Compound Name | (2R,3R)-2-fluoro-3-iodooxane |
| PubChem CID | 23236908 |
| Molecular Formula | C5H8FIO |
| Molecular Weight | 230.02 g/mol |
| Exact Mass | 229.96 |
| IUPAC Name | (2R,3R)-2-fluoro-3-iodooxane |
| SMILES | F[C@H]1OCCC[C@H]1I |
| InChI | InChI=1S/C5H8FIO/c6-5-4(7)2-1-3-8-5/h4-5H,1-3H2/t4-,5+/m1/s1 |
| InChIKey | NAGPDXICGINQLP-UHNVWZDZSA-N |
| XLogP | 1.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.02 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2-fluoro-3-iodooxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2-fluoro-3-iodooxane?
The IUPAC name of (2R,3R)-2-fluoro-3-iodooxane (CID 23236908) is (2R,3R)-2-fluoro-3-iodooxane.
What is the SMILES notation for (2R,3R)-2-fluoro-3-iodooxane?
The canonical SMILES for (2R,3R)-2-fluoro-3-iodooxane is F[C@H]1OCCC[C@H]1I.
What is the InChIKey of (2R,3R)-2-fluoro-3-iodooxane?
The InChIKey is NAGPDXICGINQLP-UHNVWZDZSA-N. The full InChI is InChI=1S/C5H8FIO/c6-5-4(7)2-1-3-8-5/h4-5H,1-3H2/t4-,5+/m1/s1.
What are the key properties of (2R,3R)-2-fluoro-3-iodooxane?
(2R,3R)-2-fluoro-3-iodooxane has a molecular weight of 230.02 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2-fluoro-3-iodooxane is sourced from PubChem (CID 23236908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).