C15H11F3O2 — CID 23236944
3,3,3-trifluoro-2-hydroxy-1,2-diphenylpropan-1-one (PubChem CID 23236944) has the molecular formula C15H11F3O2 and a molecular weight of 280.25 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-hydroxy-1,2-diphenylpropan-1-one.
| Compound Name | 3,3,3-trifluoro-2-hydroxy-1,2-diphenylpropan-1-one |
|---|---|
| PubChem CID | 23236944 |
| Molecular Formula | C15H11F3O2 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 3,3,3-trifluoro-2-hydroxy-1,2-diphenylpropan-1-one |
| SMILES | O=C(c1ccccc1)C(O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H11F3O2/c16-15(17,18)14(20,12-9-5-2-6-10-12)13(19)11-7-3-1-4-8-11/h1-10,20H |
| InChIKey | RYNWUVWFNQMIRO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |