About [2,2-difluoro-2-(1H-imidazol-1-ium-4-yl)ethyl]azanium
[2,2-difluoro-2-(1H-imidazol-1-ium-4-yl)ethyl]azanium (PubChem CID 23236972) has the molecular formula C5H9F2N3+2
and a molecular weight of 149.14 g/mol. Its IUPAC name is [2,2-difluoro-2-(1H-imidazol-1-ium-4-yl)ethyl]azanium.
Molecular Properties
| Compound Name | [2,2-difluoro-2-(1H-imidazol-1-ium-4-yl)ethyl]azanium |
| PubChem CID | 23236972 |
| Molecular Formula | C5H9F2N3+2 |
| Molecular Weight | 149.14 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | [2,2-difluoro-2-(1H-imidazol-1-ium-4-yl)ethyl]azanium |
| SMILES | [NH3+]CC(F)(F)C1=C[NH2+]C=N1 |
| InChI | InChI=1S/C5H7F2N3/c6-5(7,2-8)4-1-9-3-10-4/h1,3H,2,8H2,(H,9,10)/p+2 |
| InChIKey | MNTAYKVSZKLYOP-UHFFFAOYSA-P |
| XLogP | -1.69 |
| TPSA | 56.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.14 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [2,2-difluoro-2-(1H-imidazol-1-ium-4-yl)ethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-2-(1H-imidazol-1-ium-4-yl)ethyl]azanium?
The IUPAC name of [2,2-difluoro-2-(1H-imidazol-1-ium-4-yl)ethyl]azanium (CID 23236972) is [2,2-difluoro-2-(1H-imidazol-1-ium-4-yl)ethyl]azanium.
What is the SMILES notation for [2,2-difluoro-2-(1H-imidazol-1-ium-4-yl)ethyl]azanium?
The canonical SMILES for [2,2-difluoro-2-(1H-imidazol-1-ium-4-yl)ethyl]azanium is [NH3+]CC(F)(F)C1=C[NH2+]C=N1.
What is the InChIKey of [2,2-difluoro-2-(1H-imidazol-1-ium-4-yl)ethyl]azanium?
The InChIKey is MNTAYKVSZKLYOP-UHFFFAOYSA-P. The full InChI is InChI=1S/C5H7F2N3/c6-5(7,2-8)4-1-9-3-10-4/h1,3H,2,8H2,(H,9,10)/p+2.
What are the key properties of [2,2-difluoro-2-(1H-imidazol-1-ium-4-yl)ethyl]azanium?
[2,2-difluoro-2-(1H-imidazol-1-ium-4-yl)ethyl]azanium has a molecular weight of 149.14 g/mol, XLogP of -1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-2-(1H-imidazol-1-ium-4-yl)ethyl]azanium is sourced from PubChem (CID 23236972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).