C13H14F3NO2 — CID 23237209
(Z)-1,1,1-trifluoro-4-(2-hydroxyphenyl)-4-(propan-2-ylamino)but-3-en-2-one (PubChem CID 23237209) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-(2-hydroxyphenyl)-4-(propan-2-ylamino)but-3-en-2-one.
| Compound Name | (Z)-1,1,1-trifluoro-4-(2-hydroxyphenyl)-4-(propan-2-ylamino)but-3-en-2-one |
|---|---|
| PubChem CID | 23237209 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-(2-hydroxyphenyl)-4-(propan-2-ylamino)but-3-en-2-one |
| SMILES | CC(C)N/C(=C\C(=O)C(F)(F)F)c1ccccc1O |
| InChI | InChI=1S/C13H14F3NO2/c1-8(2)17-10(7-12(19)13(14,15)16)9-5-3-4-6-11(9)18/h3-8,17-18H,1-2H3/b10-7- |
| InChIKey | ZEWVBSQUTGYOLR-YFHOEESVSA-N |
| XLogP | 2.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|