About (1S,3R,4R,5S)-5-fluorotricyclo[2.2.1.02,6]heptan-3-ol
(1S,3R,4R,5S)-5-fluorotricyclo[2.2.1.02,6]heptan-3-ol (PubChem CID 23237257) has the molecular formula C7H9FO
and a molecular weight of 128.15 g/mol. Its IUPAC name is (1S,3R,4R,5S)-5-fluorotricyclo[2.2.1.02,6]heptan-3-ol.
Analyze (1S,3R,4R,5S)-5-fluorotricyclo[2.2.1.02,6]heptan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,3R,4R,5S)-5-fluorotricyclo[2.2.1.02,6]heptan-3-ol?
The IUPAC name of (1S,3R,4R,5S)-5-fluorotricyclo[2.2.1.02,6]heptan-3-ol (CID 23237257) is (1S,3R,4R,5S)-5-fluorotricyclo[2.2.1.02,6]heptan-3-ol.
What is the SMILES notation for (1S,3R,4R,5S)-5-fluorotricyclo[2.2.1.02,6]heptan-3-ol?
The canonical SMILES for (1S,3R,4R,5S)-5-fluorotricyclo[2.2.1.02,6]heptan-3-ol is OC1C2C3C(F)[C@@H]1C[C@@H]23.
What is the InChIKey of (1S,3R,4R,5S)-5-fluorotricyclo[2.2.1.02,6]heptan-3-ol?
The InChIKey is LSQLHVPNDWZJDC-WRDQWOPQSA-N. The full InChI is InChI=1S/C7H9FO/c8-6-3-1-2-4(6)5(2)7(3)9/h2-7,9H,1H2/t2-,3+,4?,5?,6?,7?/m1/s1.
What are the key properties of (1S,3R,4R,5S)-5-fluorotricyclo[2.2.1.02,6]heptan-3-ol?
(1S,3R,4R,5S)-5-fluorotricyclo[2.2.1.02,6]heptan-3-ol has a molecular weight of 128.15 g/mol, XLogP of 0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,3R,4R,5S)-5-fluorotricyclo[2.2.1.02,6]heptan-3-ol is sourced from PubChem (CID 23237257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).