C13H21F2NO3 — CID 23237284
[2,2-difluoro-1-[(1R,2R)-2-hydroxycyclohexyl]ethenyl] N,N-diethylcarbamate (PubChem CID 23237284) has the molecular formula C13H21F2NO3 and a molecular weight of 277.31 g/mol. Its IUPAC name is [2,2-difluoro-1-[(1R,2R)-2-hydroxycyclohexyl]ethenyl] N,N-diethylcarbamate.
| Compound Name | [2,2-difluoro-1-[(1R,2R)-2-hydroxycyclohexyl]ethenyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 23237284 |
| Molecular Formula | C13H21F2NO3 |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | [2,2-difluoro-1-[(1R,2R)-2-hydroxycyclohexyl]ethenyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OC(=C(F)F)[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C13H21F2NO3/c1-3-16(4-2)13(18)19-11(12(14)15)9-7-5-6-8-10(9)17/h9-10,17H,3-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | DQZWVQSMGXRLQS-NXEZZACHSA-N |
| XLogP | 3.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|