C10H13F3O — CID 23237285
trans-(1S,2S)-1-ethenyl-2-(1,2,2-trifluoroethenyl)cyclohexan-1-ol (PubChem CID 23237285) has the molecular formula C10H13F3O and a molecular weight of 206.21 g/mol. Its IUPAC name is trans-(1S,2S)-1-ethenyl-2-(1,2,2-trifluoroethenyl)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-1-ethenyl-2-(1,2,2-trifluoroethenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 23237285 |
| Molecular Formula | C10H13F3O |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | trans-(1S,2S)-1-ethenyl-2-(1,2,2-trifluoroethenyl)cyclohexan-1-ol |
| SMILES | C=C[C@@]1(O)CCCC[C@@H]1C(F)=C(F)F |
| InChI | InChI=1S/C10H13F3O/c1-2-10(14)6-4-3-5-7(10)8(11)9(12)13/h2,7,14H,1,3-6H2/t7-,10-/m1/s1 |
| InChIKey | NCHROOFDBMJWSQ-GMSGAONNSA-N |
| XLogP | 3.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|