C22H14Cl2F3N3OS — CID 2323733
(2R)-5-(4-chlorophenyl)-6-(4-chlorophenyl)imino-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one (PubChem CID 2323733) has the molecular formula C22H14Cl2F3N3OS and a molecular weight of 496.34 g/mol. Its IUPAC name is (2R)-5-(4-chlorophenyl)-6-(4-chlorophenyl)imino-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one.
| Compound Name | (2R)-5-(4-chlorophenyl)-6-(4-chlorophenyl)imino-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one |
|---|---|
| PubChem CID | 2323733 |
| Molecular Formula | C22H14Cl2F3N3OS |
| Molecular Weight | 496.34 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | (2R)-5-(4-chlorophenyl)-6-(4-chlorophenyl)imino-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one |
| SMILES | O=C1N[C@@](c2ccccc2)(C(F)(F)F)S/C(=N\c2ccc(Cl)cc2)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H14Cl2F3N3OS/c23-15-6-10-17(11-7-15)28-20-30(18-12-8-16(24)9-13-18)19(31)29-21(32-20,22(25,26)27)14-4-2-1-3-5-14/h1-13H,(H,29,31)/b28-20-/t21-/m1/s1 |
| InChIKey | NKWBXOHPWXNZMI-MOFIANBASA-N |
| XLogP | 7.36 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.34 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|