About N-[trifluoro(phenyl)-λ5-phosphanyl]propan-2-amine
N-[trifluoro(phenyl)-λ5-phosphanyl]propan-2-amine (PubChem CID 23237434) has the molecular formula C9H13F3NP
and a molecular weight of 223.18 g/mol. Its IUPAC name is N-[trifluoro(phenyl)-λ5-phosphanyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[trifluoro(phenyl)-λ5-phosphanyl]propan-2-amine |
| PubChem CID | 23237434 |
| Molecular Formula | C9H13F3NP |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | N-[trifluoro(phenyl)-λ5-phosphanyl]propan-2-amine |
| SMILES | CC(C)NP(F)(F)(F)c1ccccc1 |
| InChI | InChI=1S/C9H13F3NP/c1-8(2)13-14(10,11,12)9-6-4-3-5-7-9/h3-8,13H,1-2H3 |
| InChIKey | PUJCZAMZEMYIOV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[trifluoro(phenyl)-λ5-phosphanyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[trifluoro(phenyl)-λ5-phosphanyl]propan-2-amine?
The IUPAC name of N-[trifluoro(phenyl)-λ5-phosphanyl]propan-2-amine (CID 23237434) is N-[trifluoro(phenyl)-λ5-phosphanyl]propan-2-amine.
What is the SMILES notation for N-[trifluoro(phenyl)-λ5-phosphanyl]propan-2-amine?
The canonical SMILES for N-[trifluoro(phenyl)-λ5-phosphanyl]propan-2-amine is CC(C)NP(F)(F)(F)c1ccccc1.
What is the InChIKey of N-[trifluoro(phenyl)-λ5-phosphanyl]propan-2-amine?
The InChIKey is PUJCZAMZEMYIOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3NP/c1-8(2)13-14(10,11,12)9-6-4-3-5-7-9/h3-8,13H,1-2H3.
What are the key properties of N-[trifluoro(phenyl)-λ5-phosphanyl]propan-2-amine?
N-[trifluoro(phenyl)-λ5-phosphanyl]propan-2-amine has a molecular weight of 223.18 g/mol, XLogP of 3.43, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[trifluoro(phenyl)-λ5-phosphanyl]propan-2-amine is sourced from PubChem (CID 23237434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).