C8H18N3+ — CID 2323748
1,1-dimethyl-2-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yl)hydrazine (PubChem CID 2323748) has the molecular formula C8H18N3+ and a molecular weight of 156.25 g/mol. Its IUPAC name is 1,1-dimethyl-2-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yl)hydrazine.
| Compound Name | 1,1-dimethyl-2-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yl)hydrazine |
|---|---|
| PubChem CID | 2323748 |
| Molecular Formula | C8H18N3+ |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | 1,1-dimethyl-2-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yl)hydrazine |
| SMILES | CN(C)NC1=[NH+]CCCCC1 |
| InChI | InChI=1S/C8H17N3/c1-11(2)10-8-6-4-3-5-7-9-8/h3-7H2,1-2H3,(H,9,10)/p+1 |
| InChIKey | AIWHDGLTKHAQON-UHFFFAOYSA-O |
| XLogP | -0.89 |
| TPSA | 29.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|