C6F8S — CID 23237641
trifluoro-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfane (PubChem CID 23237641) has the molecular formula C6F8S and a molecular weight of 256.12 g/mol. Its IUPAC name is trifluoro-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfane.
| Compound Name | trifluoro-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfane |
|---|---|
| PubChem CID | 23237641 |
| Molecular Formula | C6F8S |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 255.96 |
| IUPAC Name | trifluoro-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfane |
| SMILES | Fc1c(F)c(F)c(S(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C6F8S/c7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9 |
| InChIKey | MOJYKDWNLIRWLS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|