C25H34NO3+ — CID 23238190
[(2S)-3-naphthalen-1-yloxy-2-[[(1R,2S,4R,6S,7R)-1,10,10-trimethyl-3-oxatricyclo[5.2.1.02,6]decan-4-yl]oxy]propyl]azanium (PubChem CID 23238190) has the molecular formula C25H34NO3+ and a molecular weight of 396.55 g/mol. Its IUPAC name is [(2S)-3-naphthalen-1-yloxy-2-[[(1R,2S,4R,6S,7R)-1,10,10-trimethyl-3-oxatricyclo[5.2.1.02,6]decan-4-yl]oxy]propyl]azanium.
| Compound Name | [(2S)-3-naphthalen-1-yloxy-2-[[(1R,2S,4R,6S,7R)-1,10,10-trimethyl-3-oxatricyclo[5.2.1.02,6]decan-4-yl]oxy]propyl]azanium |
|---|---|
| PubChem CID | 23238190 |
| Molecular Formula | C25H34NO3+ |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | [(2S)-3-naphthalen-1-yloxy-2-[[(1R,2S,4R,6S,7R)-1,10,10-trimethyl-3-oxatricyclo[5.2.1.02,6]decan-4-yl]oxy]propyl]azanium |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H]1O[C@H](O[C@@H](C[NH3+])COc3cccc4ccccc34)C[C@@H]21 |
| InChI | InChI=1S/C25H33NO3/c1-24(2)20-11-12-25(24,3)23-19(20)13-22(29-23)28-17(14-26)15-27-21-10-6-8-16-7-4-5-9-18(16)21/h4-10,17,19-20,22-23H,11-15,26H2,1-3H3/p+1/t17-,19-,20+,22-,23-,25-/m0/s1 |
| InChIKey | HPEPLDKHMRUMKE-HVWVWOKWSA-O |
| XLogP | 4.03 |
| TPSA | 55.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |