C21H24O2 — CID 23238356
(2R,5R)-6a-ethyl-3a-methyl-2,5-diphenyl-2,3,4,5-tetrahydrofuro[2,3-b]furan (PubChem CID 23238356) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is (2R,5R)-6a-ethyl-3a-methyl-2,5-diphenyl-2,3,4,5-tetrahydrofuro[2,3-b]furan.
| Compound Name | (2R,5R)-6a-ethyl-3a-methyl-2,5-diphenyl-2,3,4,5-tetrahydrofuro[2,3-b]furan |
|---|---|
| PubChem CID | 23238356 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (2R,5R)-6a-ethyl-3a-methyl-2,5-diphenyl-2,3,4,5-tetrahydrofuro[2,3-b]furan |
| SMILES | CCC12O[C@@H](c3ccccc3)CC1(C)C[C@H](c1ccccc1)O2 |
| InChI | InChI=1S/C21H24O2/c1-3-21-20(2,14-18(22-21)16-10-6-4-7-11-16)15-19(23-21)17-12-8-5-9-13-17/h4-13,18-19H,3,14-15H2,1-2H3/t18-,19-,20?,21?/m1/s1 |
| InChIKey | PECHVWGJOOGHOM-HJLBWTBNSA-N |
| XLogP | 5.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |