C22H24N5O2P — CID 2323948
2,7-dimethyl-1-morpholin-4-yl-3,5-diphenylpyrazolo[4,5-c][1,5,2]diazaphosphinine 1-oxide (PubChem CID 2323948) has the molecular formula C22H24N5O2P and a molecular weight of 421.44 g/mol. Its IUPAC name is 2,7-dimethyl-1-morpholin-4-yl-3,5-diphenylpyrazolo[4,5-c][1,5,2]diazaphosphinine 1-oxide.
| Compound Name | 2,7-dimethyl-1-morpholin-4-yl-3,5-diphenylpyrazolo[4,5-c][1,5,2]diazaphosphinine 1-oxide |
|---|---|
| PubChem CID | 2323948 |
| Molecular Formula | C22H24N5O2P |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2,7-dimethyl-1-morpholin-4-yl-3,5-diphenylpyrazolo[4,5-c][1,5,2]diazaphosphinine 1-oxide |
| SMILES | Cc1nn(-c2ccccc2)c2c1P(=O)(N1CCOCC1)N(C)C(c1ccccc1)=N2 |
| InChI | InChI=1S/C22H24N5O2P/c1-17-20-22(27(24-17)19-11-7-4-8-12-19)23-21(18-9-5-3-6-10-18)25(2)30(20,28)26-13-15-29-16-14-26/h3-12H,13-16H2,1-2H3 |
| InChIKey | BVIGOWRPYONRFZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 62.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|