About 2-methoxy-2,3-dihydro-1H-indene
2-methoxy-2,3-dihydro-1H-indene (PubChem CID 23239617) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is 2-methoxy-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 2-methoxy-2,3-dihydro-1H-indene |
| PubChem CID | 23239617 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 2-methoxy-2,3-dihydro-1H-indene |
| SMILES | COC1Cc2ccccc2C1 |
| InChI | InChI=1S/C10H12O/c1-11-10-6-8-4-2-3-5-9(8)7-10/h2-5,10H,6-7H2,1H3 |
| InChIKey | ZNVASVRRAPHQPP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methoxy-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2,3-dihydro-1H-indene?
The IUPAC name of 2-methoxy-2,3-dihydro-1H-indene (CID 23239617) is 2-methoxy-2,3-dihydro-1H-indene.
What is the SMILES notation for 2-methoxy-2,3-dihydro-1H-indene?
The canonical SMILES for 2-methoxy-2,3-dihydro-1H-indene is COC1Cc2ccccc2C1.
What is the InChIKey of 2-methoxy-2,3-dihydro-1H-indene?
The InChIKey is ZNVASVRRAPHQPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c1-11-10-6-8-4-2-3-5-9(8)7-10/h2-5,10H,6-7H2,1H3.
What are the key properties of 2-methoxy-2,3-dihydro-1H-indene?
2-methoxy-2,3-dihydro-1H-indene has a molecular weight of 148.20 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2,3-dihydro-1H-indene is sourced from PubChem (CID 23239617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).