C20H27BrO3 — CID 23239766
[(2S,4aR,8R,8aR)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-chromen-8-yl] 4-bromobenzoate (PubChem CID 23239766) has the molecular formula C20H27BrO3 and a molecular weight of 395.34 g/mol. Its IUPAC name is [(2S,4aR,8R,8aR)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-chromen-8-yl] 4-bromobenzoate.
| Compound Name | [(2S,4aR,8R,8aR)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-chromen-8-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 23239766 |
| Molecular Formula | C20H27BrO3 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | [(2S,4aR,8R,8aR)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-chromen-8-yl] 4-bromobenzoate |
| SMILES | C[C@H]1CC[C@@H]2C(C)(C)CC[C@@H](OC(=O)c3ccc(Br)cc3)[C@]2(C)O1 |
| InChI | InChI=1S/C20H27BrO3/c1-13-5-10-16-19(2,3)12-11-17(20(16,4)24-13)23-18(22)14-6-8-15(21)9-7-14/h6-9,13,16-17H,5,10-12H2,1-4H3/t13-,16+,17+,20+/m0/s1 |
| InChIKey | XKQNAHBIUBFGKQ-QIYDDFJZSA-N |
| XLogP | 5.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |