C22H34O3 — CID 23239778
(1R,2S,3R,5S,6S,7S,9R,12S,13R,16S)-6,9,13-trimethyl-4-oxapentacyclo[10.8.0.02,9.03,7.013,18]icos-18-ene-5,16-diol (PubChem CID 23239778) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is (1R,2S,3R,5S,6S,7S,9R,12S,13R,16S)-6,9,13-trimethyl-4-oxapentacyclo[10.8.0.02,9.03,7.013,18]icos-18-ene-5,16-diol.
| Compound Name | (1R,2S,3R,5S,6S,7S,9R,12S,13R,16S)-6,9,13-trimethyl-4-oxapentacyclo[10.8.0.02,9.03,7.013,18]icos-18-ene-5,16-diol |
|---|---|
| PubChem CID | 23239778 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (1R,2S,3R,5S,6S,7S,9R,12S,13R,16S)-6,9,13-trimethyl-4-oxapentacyclo[10.8.0.02,9.03,7.013,18]icos-18-ene-5,16-diol |
| SMILES | C[C@H]1[C@@H]2C[C@@]3(C)CC[C@H]4[C@@H](CC=C5C[C@@H](O)CC[C@@]54C)[C@@H]3[C@@H]2O[C@@H]1O |
| InChI | InChI=1S/C22H34O3/c1-12-16-11-21(2)8-7-17-15(18(21)19(16)25-20(12)24)5-4-13-10-14(23)6-9-22(13,17)3/h4,12,14-20,23-24H,5-11H2,1-3H3/t12-,14-,15+,16-,17-,18+,19+,20-,21+,22-/m0/s1 |
| InChIKey | NXRDACONDFZTLZ-SQBRQBLNSA-N |
| XLogP | 3.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|