C9H15BrO5 — CID 23239783
[(2S,3S,4R,5S,6S)-3-bromo-2,5-dimethoxy-6-methyloxan-4-yl] formate (PubChem CID 23239783) has the molecular formula C9H15BrO5 and a molecular weight of 283.12 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6S)-3-bromo-2,5-dimethoxy-6-methyloxan-4-yl] formate.
| Compound Name | [(2S,3S,4R,5S,6S)-3-bromo-2,5-dimethoxy-6-methyloxan-4-yl] formate |
|---|---|
| PubChem CID | 23239783 |
| Molecular Formula | C9H15BrO5 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | [(2S,3S,4R,5S,6S)-3-bromo-2,5-dimethoxy-6-methyloxan-4-yl] formate |
| SMILES | CO[C@H]1O[C@@H](C)[C@H](OC)[C@@H](OC=O)[C@@H]1Br |
| InChI | InChI=1S/C9H15BrO5/c1-5-7(12-2)8(14-4-11)6(10)9(13-3)15-5/h4-9H,1-3H3/t5-,6-,7-,8-,9-/m0/s1 |
| InChIKey | ITKQCFYQLWJTMT-LJASKYJCSA-N |
| XLogP | 0.70 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|