C13H12F6O6 — CID 23240056
[(3aR,5R,6R,7aS)-7a-methyl-1-oxo-6-(2,2,2-trifluoroacetyl)oxy-3,3a,4,5,6,7-hexahydro-2-benzofuran-5-yl] 2,2,2-trifluoroacetate (PubChem CID 23240056) has the molecular formula C13H12F6O6 and a molecular weight of 378.22 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-7a-methyl-1-oxo-6-(2,2,2-trifluoroacetyl)oxy-3,3a,4,5,6,7-hexahydro-2-benzofuran-5-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(3aR,5R,6R,7aS)-7a-methyl-1-oxo-6-(2,2,2-trifluoroacetyl)oxy-3,3a,4,5,6,7-hexahydro-2-benzofuran-5-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 23240056 |
| Molecular Formula | C13H12F6O6 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | [(3aR,5R,6R,7aS)-7a-methyl-1-oxo-6-(2,2,2-trifluoroacetyl)oxy-3,3a,4,5,6,7-hexahydro-2-benzofuran-5-yl] 2,2,2-trifluoroacetate |
| SMILES | C[C@]12C[C@@H](OC(=O)C(F)(F)F)[C@H](OC(=O)C(F)(F)F)C[C@H]1COC2=O |
| InChI | InChI=1S/C13H12F6O6/c1-11-3-7(25-10(22)13(17,18)19)6(24-9(21)12(14,15)16)2-5(11)4-23-8(11)20/h5-7H,2-4H2,1H3/t5-,6+,7+,11-/m0/s1 |
| InChIKey | GPFPVJDQXZSGBY-LLVCWYDASA-N |
| XLogP | 1.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|