C21H21N4O2PS — CID 2324081
7-methyl-1-morpholin-4-yl-3,5-diphenyl-1-sulfanylidenepyrazolo[4,5-c][1,5,2]oxazaphosphinine (PubChem CID 2324081) has the molecular formula C21H21N4O2PS and a molecular weight of 424.47 g/mol. Its IUPAC name is 7-methyl-1-morpholin-4-yl-3,5-diphenyl-1-sulfanylidenepyrazolo[4,5-c][1,5,2]oxazaphosphinine.
| Compound Name | 7-methyl-1-morpholin-4-yl-3,5-diphenyl-1-sulfanylidenepyrazolo[4,5-c][1,5,2]oxazaphosphinine |
|---|---|
| PubChem CID | 2324081 |
| Molecular Formula | C21H21N4O2PS |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 7-methyl-1-morpholin-4-yl-3,5-diphenyl-1-sulfanylidenepyrazolo[4,5-c][1,5,2]oxazaphosphinine |
| SMILES | Cc1nn(-c2ccccc2)c2c1P(=S)(N1CCOCC1)OC(c1ccccc1)=N2 |
| InChI | InChI=1S/C21H21N4O2PS/c1-16-19-20(25(23-16)18-10-6-3-7-11-18)22-21(17-8-4-2-5-9-17)27-28(19,29)24-12-14-26-15-13-24/h2-11H,12-15H2,1H3 |
| InChIKey | CHVORTBSEXACBV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|