C17H34O3Si — CID 23241046
(Z)-6-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-4-(trimethylsilylmethyl)hex-3-en-1-ol (PubChem CID 23241046) has the molecular formula C17H34O3Si and a molecular weight of 314.54 g/mol. Its IUPAC name is (Z)-6-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-4-(trimethylsilylmethyl)hex-3-en-1-ol.
| Compound Name | (Z)-6-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-4-(trimethylsilylmethyl)hex-3-en-1-ol |
|---|---|
| PubChem CID | 23241046 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | (Z)-6-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-4-(trimethylsilylmethyl)hex-3-en-1-ol |
| SMILES | CC1(C)OC(CC/C(=C/CCO)C[Si](C)(C)C)C(C)(C)O1 |
| InChI | InChI=1S/C17H34O3Si/c1-16(2)15(19-17(3,4)20-16)11-10-14(9-8-12-18)13-21(5,6)7/h9,15,18H,8,10-13H2,1-7H3/b14-9- |
| InChIKey | PFPDLQOXLXTYLZ-ZROIWOOFSA-N |
| XLogP | 4.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|