C18H23N — CID 23241207
5-tert-butyl-2-phenyl-4,5,6,7-tetrahydro-1H-indole (PubChem CID 23241207) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is 5-tert-butyl-2-phenyl-4,5,6,7-tetrahydro-1H-indole.
| Compound Name | 5-tert-butyl-2-phenyl-4,5,6,7-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 23241207 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 5-tert-butyl-2-phenyl-4,5,6,7-tetrahydro-1H-indole |
| SMILES | CC(C)(C)C1CCc2[nH]c(-c3ccccc3)cc2C1 |
| InChI | InChI=1S/C18H23N/c1-18(2,3)15-9-10-16-14(11-15)12-17(19-16)13-7-5-4-6-8-13/h4-8,12,15,19H,9-11H2,1-3H3 |
| InChIKey | MMJIPRYFEJVDMX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |