About ethyl (6R)-6-hydroxy-5,5,6-trimethyl-4H-oxazine-3-carboxylate
ethyl (6R)-6-hydroxy-5,5,6-trimethyl-4H-oxazine-3-carboxylate (PubChem CID 23241211) has the molecular formula C10H17NO4
and a molecular weight of 215.25 g/mol. Its IUPAC name is ethyl (6R)-6-hydroxy-5,5,6-trimethyl-4H-oxazine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl (6R)-6-hydroxy-5,5,6-trimethyl-4H-oxazine-3-carboxylate |
| PubChem CID | 23241211 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | ethyl (6R)-6-hydroxy-5,5,6-trimethyl-4H-oxazine-3-carboxylate |
| SMILES | CCOC(=O)C1=NO[C@@](C)(O)C(C)(C)C1 |
| InChI | InChI=1S/C10H17NO4/c1-5-14-8(12)7-6-9(2,3)10(4,13)15-11-7/h13H,5-6H2,1-4H3/t10-/m1/s1 |
| InChIKey | BAXMHGAAYXRPQJ-SNVBAGLBSA-N |
| XLogP | 1.06 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (6R)-6-hydroxy-5,5,6-trimethyl-4H-oxazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (6R)-6-hydroxy-5,5,6-trimethyl-4H-oxazine-3-carboxylate?
The IUPAC name of ethyl (6R)-6-hydroxy-5,5,6-trimethyl-4H-oxazine-3-carboxylate (CID 23241211) is ethyl (6R)-6-hydroxy-5,5,6-trimethyl-4H-oxazine-3-carboxylate.
What is the SMILES notation for ethyl (6R)-6-hydroxy-5,5,6-trimethyl-4H-oxazine-3-carboxylate?
The canonical SMILES for ethyl (6R)-6-hydroxy-5,5,6-trimethyl-4H-oxazine-3-carboxylate is CCOC(=O)C1=NO[C@@](C)(O)C(C)(C)C1.
What is the InChIKey of ethyl (6R)-6-hydroxy-5,5,6-trimethyl-4H-oxazine-3-carboxylate?
The InChIKey is BAXMHGAAYXRPQJ-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H17NO4/c1-5-14-8(12)7-6-9(2,3)10(4,13)15-11-7/h13H,5-6H2,1-4H3/t10-/m1/s1.
What are the key properties of ethyl (6R)-6-hydroxy-5,5,6-trimethyl-4H-oxazine-3-carboxylate?
ethyl (6R)-6-hydroxy-5,5,6-trimethyl-4H-oxazine-3-carboxylate has a molecular weight of 215.25 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (6R)-6-hydroxy-5,5,6-trimethyl-4H-oxazine-3-carboxylate is sourced from PubChem (CID 23241211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).