C45H43F6NO9S — CID 23241396
[(1S,2S,3S,4R,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] trifluoromethanesulfonate (PubChem CID 23241396) has the molecular formula C45H43F6NO9S and a molecular weight of 887.89 g/mol. Its IUPAC name is [(1S,2S,3S,4R,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] trifluoromethanesulfonate.
| Compound Name | [(1S,2S,3S,4R,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 23241396 |
| Molecular Formula | C45H43F6NO9S |
| Molecular Weight | 887.89 g/mol |
| Exact Mass | 887.26 |
| IUPAC Name | [(1S,2S,3S,4R,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] trifluoromethanesulfonate |
| SMILES | O=C(N[C@@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@](COCc2ccccc2)(OCc2ccccc2)[C@H]1OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C45H43F6NO9S/c46-44(47,48)42(53)52-37-38(57-27-33-18-8-2-9-19-33)39(58-28-34-20-10-3-11-21-34)41(59-29-35-22-12-4-13-23-35)43(60-30-36-24-14-5-15-25-36,31-56-26-32-16-6-1-7-17-32)40(37)61-62(54,55)45(49,50)51/h1-25,37-41H,26-31H2,(H,52,53)/t37-,38+,39-,40+,41+,43-/m1/s1 |
| InChIKey | VVOWBFVUTCWSHJ-KIGKKWDHSA-N |
| XLogP | 8.21 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.89 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|