C44H43F3N4O6 — CID 23241399
N-[(1R,2S,3S,4R,5S,6R)-6-azido-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)cyclohexyl]-2,2,2-trifluoroacetamide (PubChem CID 23241399) has the molecular formula C44H43F3N4O6 and a molecular weight of 780.84 g/mol. Its IUPAC name is N-[(1R,2S,3S,4R,5S,6R)-6-azido-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)cyclohexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1R,2S,3S,4R,5S,6R)-6-azido-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)cyclohexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 23241399 |
| Molecular Formula | C44H43F3N4O6 |
| Molecular Weight | 780.84 g/mol |
| Exact Mass | 780.31 |
| IUPAC Name | N-[(1R,2S,3S,4R,5S,6R)-6-azido-2,3,4,5-tetrakis(phenylmethoxy)-2-(phenylmethoxymethyl)cyclohexyl]-2,2,2-trifluoroacetamide |
| SMILES | [N-]=[N+]=N[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@](COCc2ccccc2)(OCc2ccccc2)[C@@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C44H43F3N4O6/c45-44(46,47)42(52)49-40-37(50-51-48)38(54-27-33-18-8-2-9-19-33)39(55-28-34-20-10-3-11-21-34)41(56-29-35-22-12-4-13-23-35)43(40,57-30-36-24-14-5-15-25-36)31-53-26-32-16-6-1-7-17-32/h1-25,37-41H,26-31H2,(H,49,52)/t37-,38-,39+,40+,41-,43+/m0/s1 |
| InChIKey | HYPKRPVNZPWOQZ-BADIJOOUSA-N |
| XLogP | 8.65 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.84 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|