C33H44O22 — CID 23241411
[(2R,3R,4S,5R,6R)-4,5,6-triacetyloxy-3-[(1R,2S,3R,4S,5R,6S)-2,3,4,5,6-pentaacetyloxy-3-(acetyloxymethyl)cyclohexyl]oxyoxan-2-yl]methyl acetate (PubChem CID 23241411) has the molecular formula C33H44O22 and a molecular weight of 792.69 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5,6-triacetyloxy-3-[(1R,2S,3R,4S,5R,6S)-2,3,4,5,6-pentaacetyloxy-3-(acetyloxymethyl)cyclohexyl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5,6-triacetyloxy-3-[(1R,2S,3R,4S,5R,6S)-2,3,4,5,6-pentaacetyloxy-3-(acetyloxymethyl)cyclohexyl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 23241411 |
| Molecular Formula | C33H44O22 |
| Molecular Weight | 792.69 g/mol |
| Exact Mass | 792.23 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5,6-triacetyloxy-3-[(1R,2S,3R,4S,5R,6S)-2,3,4,5,6-pentaacetyloxy-3-(acetyloxymethyl)cyclohexyl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1O[C@@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@](COC(C)=O)(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H44O22/c1-13(34)44-11-23-24(25(46-15(3)36)29(49-18(6)39)32(53-23)52-21(9)42)54-28-26(47-16(4)37)27(48-17(5)38)30(50-19(7)40)33(55-22(10)43,12-45-14(2)35)31(28)51-20(8)41/h23-32H,11-12H2,1-10H3/t23-,24-,25+,26-,27-,28-,29-,30+,31+,32+,33+/m1/s1 |
| InChIKey | PCWGTDHXMLQLRL-LAKFCMJASA-N |
| XLogP | -0.94 |
| TPSA | 281.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.69 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|