About methyl (3R,6S)-6-(1,3-dioxolan-2-yl)-3-methyl-5-oxocyclohexene-1-carboxylate
methyl (3R,6S)-6-(1,3-dioxolan-2-yl)-3-methyl-5-oxocyclohexene-1-carboxylate (PubChem CID 23241492) has the molecular formula C12H16O5
and a molecular weight of 240.25 g/mol. Its IUPAC name is methyl (3R,6S)-6-(1,3-dioxolan-2-yl)-3-methyl-5-oxocyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (3R,6S)-6-(1,3-dioxolan-2-yl)-3-methyl-5-oxocyclohexene-1-carboxylate |
| PubChem CID | 23241492 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | methyl (3R,6S)-6-(1,3-dioxolan-2-yl)-3-methyl-5-oxocyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C[C@H](C)CC(=O)[C@@H]1C1OCCO1 |
| InChI | InChI=1S/C12H16O5/c1-7-5-8(11(14)15-2)10(9(13)6-7)12-16-3-4-17-12/h5,7,10,12H,3-4,6H2,1-2H3/t7-,10+/m0/s1 |
| InChIKey | MJQXPYNUPRYNDN-OIBJUYFYSA-N |
| XLogP | 0.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (3R,6S)-6-(1,3-dioxolan-2-yl)-3-methyl-5-oxocyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3R,6S)-6-(1,3-dioxolan-2-yl)-3-methyl-5-oxocyclohexene-1-carboxylate?
The IUPAC name of methyl (3R,6S)-6-(1,3-dioxolan-2-yl)-3-methyl-5-oxocyclohexene-1-carboxylate (CID 23241492) is methyl (3R,6S)-6-(1,3-dioxolan-2-yl)-3-methyl-5-oxocyclohexene-1-carboxylate.
What is the SMILES notation for methyl (3R,6S)-6-(1,3-dioxolan-2-yl)-3-methyl-5-oxocyclohexene-1-carboxylate?
The canonical SMILES for methyl (3R,6S)-6-(1,3-dioxolan-2-yl)-3-methyl-5-oxocyclohexene-1-carboxylate is COC(=O)C1=C[C@H](C)CC(=O)[C@@H]1C1OCCO1.
What is the InChIKey of methyl (3R,6S)-6-(1,3-dioxolan-2-yl)-3-methyl-5-oxocyclohexene-1-carboxylate?
The InChIKey is MJQXPYNUPRYNDN-OIBJUYFYSA-N. The full InChI is InChI=1S/C12H16O5/c1-7-5-8(11(14)15-2)10(9(13)6-7)12-16-3-4-17-12/h5,7,10,12H,3-4,6H2,1-2H3/t7-,10+/m0/s1.
What are the key properties of methyl (3R,6S)-6-(1,3-dioxolan-2-yl)-3-methyl-5-oxocyclohexene-1-carboxylate?
methyl (3R,6S)-6-(1,3-dioxolan-2-yl)-3-methyl-5-oxocyclohexene-1-carboxylate has a molecular weight of 240.25 g/mol, XLogP of 0.68, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R,6S)-6-(1,3-dioxolan-2-yl)-3-methyl-5-oxocyclohexene-1-carboxylate is sourced from PubChem (CID 23241492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).