C11H16N2 — CID 23241542
2,5-dimethyl-1,2,3,4-tetrahydro-1,5-benzodiazepine (PubChem CID 23241542) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,5-dimethyl-1,2,3,4-tetrahydro-1,5-benzodiazepine.
| Compound Name | 2,5-dimethyl-1,2,3,4-tetrahydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 23241542 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2,5-dimethyl-1,2,3,4-tetrahydro-1,5-benzodiazepine |
| SMILES | CC1CCN(C)c2ccccc2N1 |
| InChI | InChI=1S/C11H16N2/c1-9-7-8-13(2)11-6-4-3-5-10(11)12-9/h3-6,9,12H,7-8H2,1-2H3 |
| InChIKey | AGABNIRAYIUGKB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |