C17H25N4O7- — CID 23241587
(2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 23241587) has the molecular formula C17H25N4O7- and a molecular weight of 397.41 g/mol. Its IUPAC name is (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 23241587 |
| Molecular Formula | C17H25N4O7- |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | Cc1cn(CC(=O)N[C@@H](CCCNC(=O)OC(C)(C)C)C(=O)[O-])c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H26N4O7/c1-10-8-21(15(26)20-13(10)23)9-12(22)19-11(14(24)25)6-5-7-18-16(27)28-17(2,3)4/h8,11H,5-7,9H2,1-4H3,(H,18,27)(H,19,22)(H,24,25)(H,20,23,26)/p-1/t11-/m0/s1 |
| InChIKey | SFXRMNQEDFXAJE-NSHDSACASA-M |
| XLogP | -1.62 |
| TPSA | 162.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|