C10H20F4N2O3S+2 — CID 2324161
2,2,3,3-tetrafluoropropyl 2-(4-methylpiperazine-1,4-diium-1-yl)ethanesulfonate (PubChem CID 2324161) has the molecular formula C10H20F4N2O3S+2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 2-(4-methylpiperazine-1,4-diium-1-yl)ethanesulfonate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 2-(4-methylpiperazine-1,4-diium-1-yl)ethanesulfonate |
|---|---|
| PubChem CID | 2324161 |
| Molecular Formula | C10H20F4N2O3S+2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 2-(4-methylpiperazine-1,4-diium-1-yl)ethanesulfonate |
| SMILES | C[NH+]1CC[NH+](CCS(=O)(=O)OCC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C10H18F4N2O3S/c1-15-2-4-16(5-3-15)6-7-20(17,18)19-8-10(13,14)9(11)12/h9H,2-8H2,1H3/p+2 |
| InChIKey | BXAMPCIGPVWNQT-UHFFFAOYSA-P |
| XLogP | -2.35 |
| TPSA | 52.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|