About 1-(5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)azepan-1-ium
1-(5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)azepan-1-ium (PubChem CID 2324207) has the molecular formula C18H31N2+
and a molecular weight of 275.46 g/mol. Its IUPAC name is 1-(5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)azepan-1-ium.
Molecular Properties
| Compound Name | 1-(5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)azepan-1-ium |
| PubChem CID | 2324207 |
| Molecular Formula | C18H31N2+ |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.25 |
| IUPAC Name | 1-(5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)azepan-1-ium |
| SMILES | CC1(C)CC(N2CCCC2)=CC(=[N+]2CCCCCC2)C1 |
| InChI | InChI=1S/C18H31N2/c1-18(2)14-16(19-9-5-3-4-6-10-19)13-17(15-18)20-11-7-8-12-20/h13H,3-12,14-15H2,1-2H3/q+1 |
| InChIKey | SZWJOMFGHPFQSN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)azepan-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)azepan-1-ium?
The IUPAC name of 1-(5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)azepan-1-ium (CID 2324207) is 1-(5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)azepan-1-ium.
What is the SMILES notation for 1-(5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)azepan-1-ium?
The canonical SMILES for 1-(5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)azepan-1-ium is CC1(C)CC(N2CCCC2)=CC(=[N+]2CCCCCC2)C1.
What is the InChIKey of 1-(5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)azepan-1-ium?
The InChIKey is SZWJOMFGHPFQSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N2/c1-18(2)14-16(19-9-5-3-4-6-10-19)13-17(15-18)20-11-7-8-12-20/h13H,3-12,14-15H2,1-2H3/q+1.
What are the key properties of 1-(5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)azepan-1-ium?
1-(5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)azepan-1-ium has a molecular weight of 275.46 g/mol, XLogP of 3.81, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)azepan-1-ium is sourced from PubChem (CID 2324207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).