C11H18O2 — CID 23242119
(3R,3aR,6R,7aR)-3,6-dimethyl-5-methylidene-2,3,3a,4,7,7a-hexahydro-1-benzofuran-6-ol (PubChem CID 23242119) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (3R,3aR,6R,7aR)-3,6-dimethyl-5-methylidene-2,3,3a,4,7,7a-hexahydro-1-benzofuran-6-ol.
| Compound Name | (3R,3aR,6R,7aR)-3,6-dimethyl-5-methylidene-2,3,3a,4,7,7a-hexahydro-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 23242119 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (3R,3aR,6R,7aR)-3,6-dimethyl-5-methylidene-2,3,3a,4,7,7a-hexahydro-1-benzofuran-6-ol |
| SMILES | C=C1C[C@@H]2[C@@H](C)CO[C@@H]2C[C@@]1(C)O |
| InChI | InChI=1S/C11H18O2/c1-7-6-13-10-5-11(3,12)8(2)4-9(7)10/h7,9-10,12H,2,4-6H2,1,3H3/t7-,9+,10+,11+/m0/s1 |
| InChIKey | CYUZECGMNCIFKA-AYHFEMFVSA-N |
| XLogP | 1.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|