C28H39NO4 — CID 23242433
(1S,2S,6R,14R,15R,16R)-16-[(2S)-2-hydroxy-3,3-dimethylbutan-2-yl]-15-methoxy-5-prop-2-enyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol (PubChem CID 23242433) has the molecular formula C28H39NO4 and a molecular weight of 453.62 g/mol. Its IUPAC name is (1S,2S,6R,14R,15R,16R)-16-[(2S)-2-hydroxy-3,3-dimethylbutan-2-yl]-15-methoxy-5-prop-2-enyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol.
| Compound Name | (1S,2S,6R,14R,15R,16R)-16-[(2S)-2-hydroxy-3,3-dimethylbutan-2-yl]-15-methoxy-5-prop-2-enyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol |
|---|---|
| PubChem CID | 23242433 |
| Molecular Formula | C28H39NO4 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | (1S,2S,6R,14R,15R,16R)-16-[(2S)-2-hydroxy-3,3-dimethylbutan-2-yl]-15-methoxy-5-prop-2-enyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@]2(OC)CC[C@@]3(C[C@@H]2[C@](C)(O)C(C)(C)C)[C@H]1C5 |
| InChI | InChI=1S/C28H39NO4/c1-7-13-29-14-12-27-21-17-8-9-18(30)22(21)33-23(27)28(32-6)11-10-26(27,20(29)15-17)16-19(28)25(5,31)24(2,3)4/h7-9,19-20,23,30-31H,1,10-16H2,2-6H3/t19-,20-,23-,25+,26-,27+,28-/m1/s1 |
| InChIKey | OARWEJGSBQMKSA-JOJQJKSDSA-N |
| XLogP | 4.19 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|