C15H26O4 — CID 23242496
(Z,2R,3S)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methoxy-2,6-dimethylhept-6-enal (PubChem CID 23242496) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (Z,2R,3S)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methoxy-2,6-dimethylhept-6-enal.
| Compound Name | (Z,2R,3S)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methoxy-2,6-dimethylhept-6-enal |
|---|---|
| PubChem CID | 23242496 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (Z,2R,3S)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methoxy-2,6-dimethylhept-6-enal |
| SMILES | CO[C@@H](CC/C(C)=C\C1COC(C)(C)O1)[C@@H](C)C=O |
| InChI | InChI=1S/C15H26O4/c1-11(6-7-14(17-5)12(2)9-16)8-13-10-18-15(3,4)19-13/h8-9,12-14H,6-7,10H2,1-5H3/b11-8-/t12-,13?,14-/m0/s1 |
| InChIKey | MPIVNXQWIPDTMG-AWUUBWGLSA-N |
| XLogP | 2.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|