C22H36O5 — CID 23242499
ethyl (2Z,4E,6S,7S,10Z)-11-(2,2-dimethyl-1,3-dioxolan-4-yl)-7-methoxy-2,6,10-trimethylundeca-2,4,10-trienoate (PubChem CID 23242499) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is ethyl (2Z,4E,6S,7S,10Z)-11-(2,2-dimethyl-1,3-dioxolan-4-yl)-7-methoxy-2,6,10-trimethylundeca-2,4,10-trienoate.
| Compound Name | ethyl (2Z,4E,6S,7S,10Z)-11-(2,2-dimethyl-1,3-dioxolan-4-yl)-7-methoxy-2,6,10-trimethylundeca-2,4,10-trienoate |
|---|---|
| PubChem CID | 23242499 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | ethyl (2Z,4E,6S,7S,10Z)-11-(2,2-dimethyl-1,3-dioxolan-4-yl)-7-methoxy-2,6,10-trimethylundeca-2,4,10-trienoate |
| SMILES | CCOC(=O)/C(C)=C\C=C\[C@H](C)[C@H](CC/C(C)=C\C1COC(C)(C)O1)OC |
| InChI | InChI=1S/C22H36O5/c1-8-25-21(23)18(4)11-9-10-17(3)20(24-7)13-12-16(2)14-19-15-26-22(5,6)27-19/h9-11,14,17,19-20H,8,12-13,15H2,1-7H3/b10-9+,16-14-,18-11-/t17-,19?,20-/m0/s1 |
| InChIKey | KYEKQKCFDPCJIA-OBKADSICSA-N |
| XLogP | 4.58 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|