C22H32O6 — CID 23242507
dimethyl (4aR,4bS,7S,8S,8aS,10aR)-7-methoxy-4b,8,10a-trimethyl-4-oxo-1,3,4a,5,6,7,8,8a-octahydrophenanthrene-2,2-dicarboxylate (PubChem CID 23242507) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is dimethyl (4aR,4bS,7S,8S,8aS,10aR)-7-methoxy-4b,8,10a-trimethyl-4-oxo-1,3,4a,5,6,7,8,8a-octahydrophenanthrene-2,2-dicarboxylate.
| Compound Name | dimethyl (4aR,4bS,7S,8S,8aS,10aR)-7-methoxy-4b,8,10a-trimethyl-4-oxo-1,3,4a,5,6,7,8,8a-octahydrophenanthrene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 23242507 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | dimethyl (4aR,4bS,7S,8S,8aS,10aR)-7-methoxy-4b,8,10a-trimethyl-4-oxo-1,3,4a,5,6,7,8,8a-octahydrophenanthrene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(=O)[C@H]2[C@@]3(C)CC[C@H](OC)[C@@H](C)[C@@H]3C=C[C@@]2(C)C1 |
| InChI | InChI=1S/C22H32O6/c1-13-14-7-9-20(2)12-22(18(24)27-5,19(25)28-6)11-15(23)17(20)21(14,3)10-8-16(13)26-4/h7,9,13-14,16-17H,8,10-12H2,1-6H3/t13-,14-,16-,17+,20-,21-/m0/s1 |
| InChIKey | YMDBIVOCZGLIGR-NUDWEQGUSA-N |
| XLogP | 2.94 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|