C13H15N3O — CID 23242647
6-methyl-5,6,8,9,10,11-hexahydropyrido[3,2-b][1,4]benzodiazepin-7-one (PubChem CID 23242647) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 6-methyl-5,6,8,9,10,11-hexahydropyrido[3,2-b][1,4]benzodiazepin-7-one.
| Compound Name | 6-methyl-5,6,8,9,10,11-hexahydropyrido[3,2-b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 23242647 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 6-methyl-5,6,8,9,10,11-hexahydropyrido[3,2-b][1,4]benzodiazepin-7-one |
| SMILES | CC1Nc2ncccc2NC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C13H15N3O/c1-8-12-9(4-2-6-11(12)17)16-10-5-3-7-14-13(10)15-8/h3,5,7-8,16H,2,4,6H2,1H3,(H,14,15) |
| InChIKey | DWRCIZCQZUJOTJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |