C22H34O3 — CID 23242742
[(2E,6E,10E)-3,7,11,15-tetramethyl-13-oxohexadeca-2,6,10,14-tetraenyl] acetate (PubChem CID 23242742) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(2E,6E,10E)-3,7,11,15-tetramethyl-13-oxohexadeca-2,6,10,14-tetraenyl] acetate.
| Compound Name | [(2E,6E,10E)-3,7,11,15-tetramethyl-13-oxohexadeca-2,6,10,14-tetraenyl] acetate |
|---|---|
| PubChem CID | 23242742 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(2E,6E,10E)-3,7,11,15-tetramethyl-13-oxohexadeca-2,6,10,14-tetraenyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC(=O)C=C(C)C |
| InChI | InChI=1S/C22H34O3/c1-17(2)15-22(24)16-20(5)12-8-10-18(3)9-7-11-19(4)13-14-25-21(6)23/h9,12-13,15H,7-8,10-11,14,16H2,1-6H3/b18-9+,19-13+,20-12+ |
| InChIKey | XLRINIVOESDDOA-QGBQGRNXSA-N |
| XLogP | 5.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|