C25H48O4Si — CID 23242992
(2Z,6R,7R,8E,10Z)-6-(methoxymethoxy)-3,7-dimethyl-12-tri(propan-2-yl)silyloxydodeca-2,8,10-trien-1-ol (PubChem CID 23242992) has the molecular formula C25H48O4Si and a molecular weight of 440.74 g/mol. Its IUPAC name is (2Z,6R,7R,8E,10Z)-6-(methoxymethoxy)-3,7-dimethyl-12-tri(propan-2-yl)silyloxydodeca-2,8,10-trien-1-ol.
| Compound Name | (2Z,6R,7R,8E,10Z)-6-(methoxymethoxy)-3,7-dimethyl-12-tri(propan-2-yl)silyloxydodeca-2,8,10-trien-1-ol |
|---|---|
| PubChem CID | 23242992 |
| Molecular Formula | C25H48O4Si |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | (2Z,6R,7R,8E,10Z)-6-(methoxymethoxy)-3,7-dimethyl-12-tri(propan-2-yl)silyloxydodeca-2,8,10-trien-1-ol |
| SMILES | COCO[C@H](CC/C(C)=C\CO)[C@H](C)/C=C/C=C\CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H48O4Si/c1-20(2)30(21(3)4,22(5)6)29-18-12-10-11-13-24(8)25(28-19-27-9)15-14-23(7)16-17-26/h10-13,16,20-22,24-26H,14-15,17-19H2,1-9H3/b12-10-,13-11+,23-16-/t24-,25-/m1/s1 |
| InChIKey | WQDSJVMKXFFPCH-OVQHZSTHSA-N |
| XLogP | 6.63 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|