C30H57ClO5Si — CID 23242995
[(2Z,4E,6R,7R,10Z)-13-chloro-7-(methoxymethoxy)-12-(2-methoxypropan-2-yloxy)-6,10-dimethyltrideca-2,4,10-trienoxy]-tri(propan-2-yl)silane (PubChem CID 23242995) has the molecular formula C30H57ClO5Si and a molecular weight of 561.32 g/mol. Its IUPAC name is [(2Z,4E,6R,7R,10Z)-13-chloro-7-(methoxymethoxy)-12-(2-methoxypropan-2-yloxy)-6,10-dimethyltrideca-2,4,10-trienoxy]-tri(propan-2-yl)silane.
| Compound Name | [(2Z,4E,6R,7R,10Z)-13-chloro-7-(methoxymethoxy)-12-(2-methoxypropan-2-yloxy)-6,10-dimethyltrideca-2,4,10-trienoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 23242995 |
| Molecular Formula | C30H57ClO5Si |
| Molecular Weight | 561.32 g/mol |
| Exact Mass | 560.37 |
| IUPAC Name | [(2Z,4E,6R,7R,10Z)-13-chloro-7-(methoxymethoxy)-12-(2-methoxypropan-2-yloxy)-6,10-dimethyltrideca-2,4,10-trienoxy]-tri(propan-2-yl)silane |
| SMILES | COCO[C@H](CC/C(C)=C\C(CCl)OC(C)(C)OC)[C@H](C)/C=C/C=C\CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H57ClO5Si/c1-23(2)37(24(3)4,25(5)6)35-19-15-13-14-16-27(8)29(34-22-32-11)18-17-26(7)20-28(21-31)36-30(9,10)33-12/h13-16,20,23-25,27-29H,17-19,21-22H2,1-12H3/b15-13-,16-14+,26-20-/t27-,28?,29-/m1/s1 |
| InChIKey | MJKPVQSLGOZKRN-WEQJLBQISA-N |
| XLogP | 8.65 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.32 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|