C17H19F3O4 — CID 23243305
[(2S,3R)-2-ethenyloxan-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 23243305) has the molecular formula C17H19F3O4 and a molecular weight of 344.33 g/mol. Its IUPAC name is [(2S,3R)-2-ethenyloxan-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2S,3R)-2-ethenyloxan-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 23243305 |
| Molecular Formula | C17H19F3O4 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [(2S,3R)-2-ethenyloxan-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C[C@@H]1OCCC[C@H]1OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H19F3O4/c1-3-13-14(10-7-11-23-13)24-15(21)16(22-2,17(18,19)20)12-8-5-4-6-9-12/h3-6,8-9,13-14H,1,7,10-11H2,2H3/t13-,14+,16-/m0/s1 |
| InChIKey | NSSVFJMOQFMJJI-LZWOXQAQSA-N |
| XLogP | 3.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|