About N-benzyl-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine
N-benzyl-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine (PubChem CID 2324339) has the molecular formula C23H20NO2P
and a molecular weight of 373.39 g/mol. Its IUPAC name is N-benzyl-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine.
Molecular Properties
| Compound Name | N-benzyl-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine |
| PubChem CID | 2324339 |
| Molecular Formula | C23H20NO2P |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-benzyl-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine |
| SMILES | O=P1(NCc2ccccc2)C=C(c2ccccc2)OC(c2ccccc2)=C1 |
| InChI | InChI=1S/C23H20NO2P/c25-27(24-16-19-10-4-1-5-11-19)17-22(20-12-6-2-7-13-20)26-23(18-27)21-14-8-3-9-15-21/h1-15,17-18H,16H2,(H,24,25) |
| InChIKey | FEPDQJJGYSXWTL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine?
The IUPAC name of N-benzyl-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine (CID 2324339) is N-benzyl-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine.
What is the SMILES notation for N-benzyl-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine?
The canonical SMILES for N-benzyl-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine is O=P1(NCc2ccccc2)C=C(c2ccccc2)OC(c2ccccc2)=C1.
What is the InChIKey of N-benzyl-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine?
The InChIKey is FEPDQJJGYSXWTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20NO2P/c25-27(24-16-19-10-4-1-5-11-19)17-22(20-12-6-2-7-13-20)26-23(18-27)21-14-8-3-9-15-21/h1-15,17-18H,16H2,(H,24,25).
What are the key properties of N-benzyl-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine?
N-benzyl-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine has a molecular weight of 373.39 g/mol, XLogP of 6.08, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine is sourced from PubChem (CID 2324339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).