C15H20F2O2S — CID 23243902
(2R,3R)-1,1-difluoro-6-methyl-3-(4-methylphenyl)sulfinylhept-5-en-2-ol (PubChem CID 23243902) has the molecular formula C15H20F2O2S and a molecular weight of 302.39 g/mol. Its IUPAC name is (2R,3R)-1,1-difluoro-6-methyl-3-(4-methylphenyl)sulfinylhept-5-en-2-ol.
| Compound Name | (2R,3R)-1,1-difluoro-6-methyl-3-(4-methylphenyl)sulfinylhept-5-en-2-ol |
|---|---|
| PubChem CID | 23243902 |
| Molecular Formula | C15H20F2O2S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (2R,3R)-1,1-difluoro-6-methyl-3-(4-methylphenyl)sulfinylhept-5-en-2-ol |
| SMILES | CC(C)=CC[C@H]([C@H](O)C(F)F)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H20F2O2S/c1-10(2)4-9-13(14(18)15(16)17)20(19)12-7-5-11(3)6-8-12/h4-8,13-15,18H,9H2,1-3H3/t13-,14+,20?/m1/s1 |
| InChIKey | CJNGSJVCLSPECB-NTCUHZHNSA-N |
| XLogP | 3.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|