C14H17NO3 — CID 23243968
[(2R,3S)-1-benzyl-2-methyl-4-oxoazetidin-3-yl]methyl acetate (PubChem CID 23243968) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is [(2R,3S)-1-benzyl-2-methyl-4-oxoazetidin-3-yl]methyl acetate.
| Compound Name | [(2R,3S)-1-benzyl-2-methyl-4-oxoazetidin-3-yl]methyl acetate |
|---|---|
| PubChem CID | 23243968 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | [(2R,3S)-1-benzyl-2-methyl-4-oxoazetidin-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C(=O)N(Cc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C14H17NO3/c1-10-13(9-18-11(2)16)14(17)15(10)8-12-6-4-3-5-7-12/h3-7,10,13H,8-9H2,1-2H3/t10-,13-/m1/s1 |
| InChIKey | ZVYNPOXZWQVZRI-ZWNOBZJWSA-N |
| XLogP | 1.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |