About CID 23244032
CID 23244032 (PubChem CID 23244032) has the molecular formula C19H25NO3
and a molecular weight of 315.41 g/mol.
Molecular Properties
| Compound Name | CID 23244032 |
| PubChem CID | 23244032 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | — |
| SMILES | c1ccc([C@H]2ON3C[C@@H]2CC32COC3(CCCCC3)OC2)cc1 |
| InChI | InChI=1S/C19H25NO3/c1-3-7-15(8-4-1)17-16-11-18(20(12-16)23-17)13-21-19(22-14-18)9-5-2-6-10-19/h1,3-4,7-8,16-17H,2,5-6,9-14H2/t16-,17+/m0/s1 |
| InChIKey | USHVDJDBBMGNTF-DLBZAZTESA-N |
| XLogP | 3.44 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 23244032 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23244032?
The IUPAC name of CID 23244032 (CID 23244032) is not available.
What is the SMILES notation for CID 23244032?
The canonical SMILES for CID 23244032 is c1ccc([C@H]2ON3C[C@@H]2CC32COC3(CCCCC3)OC2)cc1.
What is the InChIKey of CID 23244032?
The InChIKey is USHVDJDBBMGNTF-DLBZAZTESA-N. The full InChI is InChI=1S/C19H25NO3/c1-3-7-15(8-4-1)17-16-11-18(20(12-16)23-17)13-21-19(22-14-18)9-5-2-6-10-19/h1,3-4,7-8,16-17H,2,5-6,9-14H2/t16-,17+/m0/s1.
What are the key properties of CID 23244032?
CID 23244032 has a molecular weight of 315.41 g/mol, XLogP of 3.44, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23244032 is sourced from PubChem (CID 23244032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).