About (4S,6S)-2,2-bis(hydroxymethyl)-4-methyl-6-phenylpiperidin-4-ol
(4S,6S)-2,2-bis(hydroxymethyl)-4-methyl-6-phenylpiperidin-4-ol (PubChem CID 23244042) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is (4S,6S)-2,2-bis(hydroxymethyl)-4-methyl-6-phenylpiperidin-4-ol.
Molecular Properties
| Compound Name | (4S,6S)-2,2-bis(hydroxymethyl)-4-methyl-6-phenylpiperidin-4-ol |
| PubChem CID | 23244042 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (4S,6S)-2,2-bis(hydroxymethyl)-4-methyl-6-phenylpiperidin-4-ol |
| SMILES | C[C@]1(O)C[C@@H](c2ccccc2)NC(CO)(CO)C1 |
| InChI | InChI=1S/C14H21NO3/c1-13(18)7-12(11-5-3-2-4-6-11)15-14(8-13,9-16)10-17/h2-6,12,15-18H,7-10H2,1H3/t12-,13-/m0/s1 |
| InChIKey | OJMXKJZMABVOTN-STQMWFEESA-N |
| XLogP | 0.59 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S,6S)-2,2-bis(hydroxymethyl)-4-methyl-6-phenylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,6S)-2,2-bis(hydroxymethyl)-4-methyl-6-phenylpiperidin-4-ol?
The IUPAC name of (4S,6S)-2,2-bis(hydroxymethyl)-4-methyl-6-phenylpiperidin-4-ol (CID 23244042) is (4S,6S)-2,2-bis(hydroxymethyl)-4-methyl-6-phenylpiperidin-4-ol.
What is the SMILES notation for (4S,6S)-2,2-bis(hydroxymethyl)-4-methyl-6-phenylpiperidin-4-ol?
The canonical SMILES for (4S,6S)-2,2-bis(hydroxymethyl)-4-methyl-6-phenylpiperidin-4-ol is C[C@]1(O)C[C@@H](c2ccccc2)NC(CO)(CO)C1.
What is the InChIKey of (4S,6S)-2,2-bis(hydroxymethyl)-4-methyl-6-phenylpiperidin-4-ol?
The InChIKey is OJMXKJZMABVOTN-STQMWFEESA-N. The full InChI is InChI=1S/C14H21NO3/c1-13(18)7-12(11-5-3-2-4-6-11)15-14(8-13,9-16)10-17/h2-6,12,15-18H,7-10H2,1H3/t12-,13-/m0/s1.
What are the key properties of (4S,6S)-2,2-bis(hydroxymethyl)-4-methyl-6-phenylpiperidin-4-ol?
(4S,6S)-2,2-bis(hydroxymethyl)-4-methyl-6-phenylpiperidin-4-ol has a molecular weight of 251.33 g/mol, XLogP of 0.59, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,6S)-2,2-bis(hydroxymethyl)-4-methyl-6-phenylpiperidin-4-ol is sourced from PubChem (CID 23244042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).