C19H18N2 — CID 23244045
(1R,11R)-11-phenyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene (PubChem CID 23244045) has the molecular formula C19H18N2 and a molecular weight of 274.37 g/mol. Its IUPAC name is (1R,11R)-11-phenyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene.
| Compound Name | (1R,11R)-11-phenyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 23244045 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (1R,11R)-11-phenyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene |
| SMILES | c1ccc([C@@H]2c3[nH]c4ccccc4c3[C@H]3CCN2C3)cc1 |
| InChI | InChI=1S/C19H18N2/c1-2-6-13(7-3-1)19-18-17(14-10-11-21(19)12-14)15-8-4-5-9-16(15)20-18/h1-9,14,19-20H,10-12H2/t14-,19+/m0/s1 |
| InChIKey | WAIFDFTVGAZVPI-IFXJQAMLSA-N |
| XLogP | 4.06 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|