About Cespitularin D
Cespitularin D (PubChem CID 23244087) has the molecular formula C20H28O4
and a molecular weight of 332.40 g/mol. Its IUPAC name is (1R,3E,5S,10R)-1,5-dihydroxy-3,17,17-trimethyl-7-methylidene-15-oxatricyclo[8.5.2.013,16]heptadeca-3,13(16)-dien-14-one.
Molecular Properties
| Compound Name | Cespitularin D |
| PubChem CID | 23244087 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1R,3E,5S,10R)-1,5-dihydroxy-3,17,17-trimethyl-7-methylidene-15-oxatricyclo[8.5.2.013,16]heptadeca-3,13(16)-dien-14-one |
| SMILES | C/C/1=C\[C@H](CC(=C)CC[C@@H]2CCC3=C(C2(C)C)[C@@](C1)(OC3=O)O)O |
| InChI | InChI=1S/C20H28O4/c1-12-5-6-14-7-8-16-17(19(14,3)4)20(23,24-18(16)22)11-13(2)10-15(21)9-12/h10,14-15,21,23H,1,5-9,11H2,2-4H3/b13-10+/t14-,15+,20-/m1/s1 |
| InChIKey | NAXRGDYBDAKNAZ-HZDNEDPBSA-N |
| XLogP | 2.50 |
| TPSA | 66.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | 640 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Cespitularin D with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cespitularin D?
The IUPAC name of Cespitularin D (CID 23244087) is (1R,3E,5S,10R)-1,5-dihydroxy-3,17,17-trimethyl-7-methylidene-15-oxatricyclo[8.5.2.013,16]heptadeca-3,13(16)-dien-14-one.
What is the SMILES notation for Cespitularin D?
The canonical SMILES for Cespitularin D is C/C/1=C\[C@H](CC(=C)CC[C@@H]2CCC3=C(C2(C)C)[C@@](C1)(OC3=O)O)O.
What is the InChIKey of Cespitularin D?
The InChIKey is NAXRGDYBDAKNAZ-HZDNEDPBSA-N. The full InChI is InChI=1S/C20H28O4/c1-12-5-6-14-7-8-16-17(19(14,3)4)20(23,24-18(16)22)11-13(2)10-15(21)9-12/h10,14-15,21,23H,1,5-9,11H2,2-4H3/b13-10+/t14-,15+,20-/m1/s1.
What are the key properties of Cespitularin D?
Cespitularin D has a molecular weight of 332.40 g/mol, XLogP of 2.50, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Cespitularin D is sourced from PubChem (CID 23244087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).