C10H10O4 — CID 23244154
(3S,4S)-4-hydroxy-3-methyl-3,4-dihydro-1H-isochromene-5,8-dione (PubChem CID 23244154) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is (3S,4S)-4-hydroxy-3-methyl-3,4-dihydro-1H-isochromene-5,8-dione.
| Compound Name | (3S,4S)-4-hydroxy-3-methyl-3,4-dihydro-1H-isochromene-5,8-dione |
|---|---|
| PubChem CID | 23244154 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (3S,4S)-4-hydroxy-3-methyl-3,4-dihydro-1H-isochromene-5,8-dione |
| SMILES | C[C@@H]1OCC2=C(C(=O)C=CC2=O)[C@@H]1O |
| InChI | InChI=1S/C10H10O4/c1-5-10(13)9-6(4-14-5)7(11)2-3-8(9)12/h2-3,5,10,13H,4H2,1H3/t5-,10+/m0/s1 |
| InChIKey | YWRSZXXHXKZGTO-XUOSJQGZSA-N |
| XLogP | -0.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|