About (1S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol
(1S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol (PubChem CID 23244374) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is (1S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol.
Molecular Properties
| Compound Name | (1S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol |
| PubChem CID | 23244374 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | (1S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol |
| SMILES | CC(C)(O)CC[C@H](O)[C@@]1(C)CO1 |
| InChI | InChI=1S/C9H18O3/c1-8(2,11)5-4-7(10)9(3)6-12-9/h7,10-11H,4-6H2,1-3H3/t7-,9+/m0/s1 |
| InChIKey | WFIQUCUVQZAZEE-IONNQARKSA-N |
| XLogP | 0.69 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol?
The IUPAC name of (1S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol (CID 23244374) is (1S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol.
What is the SMILES notation for (1S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol?
The canonical SMILES for (1S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol is CC(C)(O)CC[C@H](O)[C@@]1(C)CO1.
What is the InChIKey of (1S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol?
The InChIKey is WFIQUCUVQZAZEE-IONNQARKSA-N. The full InChI is InChI=1S/C9H18O3/c1-8(2,11)5-4-7(10)9(3)6-12-9/h7,10-11H,4-6H2,1-3H3/t7-,9+/m0/s1.
What are the key properties of (1S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol?
(1S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol has a molecular weight of 174.24 g/mol, XLogP of 0.69, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentane-1,4-diol is sourced from PubChem (CID 23244374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).